C11H9ClN4O2 — CID 114049171
2-amino-N-(6-chloropyrimidin-4-yl)-5-hydroxybenzamide (PubChem CID 114049171) has the molecular formula C11H9ClN4O2 and a molecular weight of 264.67 g/mol. Its IUPAC name is 2-amino-N-(6-chloropyrimidin-4-yl)-5-hydroxybenzamide.
| Compound Name | 2-amino-N-(6-chloropyrimidin-4-yl)-5-hydroxybenzamide |
|---|---|
| PubChem CID | 114049171 |
| Molecular Formula | C11H9ClN4O2 |
| Molecular Weight | 264.67 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-amino-N-(6-chloropyrimidin-4-yl)-5-hydroxybenzamide |
| SMILES | Nc1ccc(O)cc1C(=O)Nc1cc(Cl)ncn1 |
| InChI | InChI=1S/C11H9ClN4O2/c12-9-4-10(15-5-14-9)16-11(18)7-3-6(17)1-2-8(7)13/h1-5,17H,13H2,(H,14,15,16,18) |
| InChIKey | NSRJNQFEJORDBQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.67 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|