C18H15Cl2N5O — CID 112866731
N-[3-[[6-(2,6-dichloroanilino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 112866731) has the molecular formula C18H15Cl2N5O and a molecular weight of 388.26 g/mol. Its IUPAC name is N-[3-[[6-(2,6-dichloroanilino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[6-(2,6-dichloroanilino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112866731 |
| Molecular Formula | C18H15Cl2N5O |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-[3-[[6-(2,6-dichloroanilino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2cc(Nc3c(Cl)cccc3Cl)ncn2)c1 |
| InChI | InChI=1S/C18H15Cl2N5O/c1-11(26)23-12-4-2-5-13(8-12)24-16-9-17(22-10-21-16)25-18-14(19)6-3-7-15(18)20/h2-10H,1H3,(H,23,26)(H2,21,22,24,25) |
| InChIKey | LEOUZYJNGKFWQT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |