C18H16FN5O — CID 112865645
N-[3-[[6-(2-fluoroanilino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 112865645) has the molecular formula C18H16FN5O and a molecular weight of 337.36 g/mol. Its IUPAC name is N-[3-[[6-(2-fluoroanilino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[6-(2-fluoroanilino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112865645 |
| Molecular Formula | C18H16FN5O |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[3-[[6-(2-fluoroanilino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2cc(Nc3ccccc3F)ncn2)c1 |
| InChI | InChI=1S/C18H16FN5O/c1-12(25)22-13-5-4-6-14(9-13)23-17-10-18(21-11-20-17)24-16-8-3-2-7-15(16)19/h2-11H,1H3,(H,22,25)(H2,20,21,23,24) |
| InChIKey | PKSWMCKZQQZJKQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |