C18H15FN4O — CID 112865643
1-[3-[[6-(2-fluoroanilino)pyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 112865643) has the molecular formula C18H15FN4O and a molecular weight of 322.34 g/mol. Its IUPAC name is 1-[3-[[6-(2-fluoroanilino)pyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[3-[[6-(2-fluoroanilino)pyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 112865643 |
| Molecular Formula | C18H15FN4O |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-[3-[[6-(2-fluoroanilino)pyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2cc(Nc3ccccc3F)ncn2)c1 |
| InChI | InChI=1S/C18H15FN4O/c1-12(24)13-5-4-6-14(9-13)22-17-10-18(21-11-20-17)23-16-8-3-2-7-15(16)19/h2-11H,1H3,(H2,20,21,22,23) |
| InChIKey | BSTPZGRWMDXENN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |