C18H13F3N4O — CID 112866661
1-[3-[[6-(2,3,4-trifluoroanilino)pyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 112866661) has the molecular formula C18H13F3N4O and a molecular weight of 358.32 g/mol. Its IUPAC name is 1-[3-[[6-(2,3,4-trifluoroanilino)pyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[3-[[6-(2,3,4-trifluoroanilino)pyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 112866661 |
| Molecular Formula | C18H13F3N4O |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1-[3-[[6-(2,3,4-trifluoroanilino)pyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2cc(Nc3ccc(F)c(F)c3F)ncn2)c1 |
| InChI | InChI=1S/C18H13F3N4O/c1-10(26)11-3-2-4-12(7-11)24-15-8-16(23-9-22-15)25-14-6-5-13(19)17(20)18(14)21/h2-9H,1H3,(H2,22,23,24,25) |
| InChIKey | GQJKFCZGJMHXHE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|