C20H19N5O3 — CID 112866713
methyl 3-[[6-(3-acetamidoanilino)pyrimidin-4-yl]amino]benzoate (PubChem CID 112866713) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is methyl 3-[[6-(3-acetamidoanilino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 3-[[6-(3-acetamidoanilino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112866713 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | methyl 3-[[6-(3-acetamidoanilino)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2cc(Nc3cccc(NC(C)=O)c3)ncn2)c1 |
| InChI | InChI=1S/C20H19N5O3/c1-13(26)23-16-7-4-8-17(10-16)25-19-11-18(21-12-22-19)24-15-6-3-5-14(9-15)20(27)28-2/h3-12H,1-2H3,(H,23,26)(H2,21,22,24,25) |
| InChIKey | MTRFXWMIEMFYQC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |