C19H16N4O3 — CID 109355850
methyl 3-[[6-(phenylcarbamoyl)pyrimidin-4-yl]amino]benzoate (PubChem CID 109355850) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is methyl 3-[[6-(phenylcarbamoyl)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 3-[[6-(phenylcarbamoyl)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 109355850 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | methyl 3-[[6-(phenylcarbamoyl)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2cc(C(=O)Nc3ccccc3)ncn2)c1 |
| InChI | InChI=1S/C19H16N4O3/c1-26-19(25)13-6-5-9-15(10-13)22-17-11-16(20-12-21-17)18(24)23-14-7-3-2-4-8-14/h2-12H,1H3,(H,23,24)(H,20,21,22) |
| InChIKey | WLDNMRDCMKPTCN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |