C18H20N4O3 — CID 109341519
methyl 3-[[6-(cyclopentylcarbamoyl)pyrimidin-4-yl]amino]benzoate (PubChem CID 109341519) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is methyl 3-[[6-(cyclopentylcarbamoyl)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 3-[[6-(cyclopentylcarbamoyl)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 109341519 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | methyl 3-[[6-(cyclopentylcarbamoyl)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2cc(C(=O)NC3CCCC3)ncn2)c1 |
| InChI | InChI=1S/C18H20N4O3/c1-25-18(24)12-5-4-8-14(9-12)21-16-10-15(19-11-20-16)17(23)22-13-6-2-3-7-13/h4-5,8-11,13H,2-3,6-7H2,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | UWKLAIMSFRNKFU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |