C19H22N4O3 — CID 109355205
methyl 3-[[6-(3-methylpiperidine-1-carbonyl)pyrimidin-4-yl]amino]benzoate (PubChem CID 109355205) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is methyl 3-[[6-(3-methylpiperidine-1-carbonyl)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 3-[[6-(3-methylpiperidine-1-carbonyl)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 109355205 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | methyl 3-[[6-(3-methylpiperidine-1-carbonyl)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2cc(C(=O)N3CCCC(C)C3)ncn2)c1 |
| InChI | InChI=1S/C19H22N4O3/c1-13-5-4-8-23(11-13)18(24)16-10-17(21-12-20-16)22-15-7-3-6-14(9-15)19(25)26-2/h3,6-7,9-10,12-13H,4-5,8,11H2,1-2H3,(H,20,21,22) |
| InChIKey | VPQVWVYJEWUQMI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |