C18H15F3N4O2 — CID 112866558
6-N-(3,4-dimethoxyphenyl)-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine (PubChem CID 112866558) has the molecular formula C18H15F3N4O2 and a molecular weight of 376.34 g/mol. Its IUPAC name is 6-N-(3,4-dimethoxyphenyl)-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-(3,4-dimethoxyphenyl)-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112866558 |
| Molecular Formula | C18H15F3N4O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 6-N-(3,4-dimethoxyphenyl)-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc(Nc2cc(Nc3ccc(F)c(F)c3F)ncn2)cc1OC |
| InChI | InChI=1S/C18H15F3N4O2/c1-26-13-6-3-10(7-14(13)27-2)24-15-8-16(23-9-22-15)25-12-5-4-11(19)17(20)18(12)21/h3-9H,1-2H3,(H2,22,23,24,25) |
| InChIKey | ZOYFSSGWWWZZHH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|