C11H11FN4O — CID 80779473
4-N-(3-fluoro-4-methoxyphenyl)pyrimidine-4,6-diamine (PubChem CID 80779473) has the molecular formula C11H11FN4O and a molecular weight of 234.23 g/mol. Its IUPAC name is 4-N-(3-fluoro-4-methoxyphenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-fluoro-4-methoxyphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80779473 |
| Molecular Formula | C11H11FN4O |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-N-(3-fluoro-4-methoxyphenyl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc(Nc2cc(N)ncn2)cc1F |
| InChI | InChI=1S/C11H11FN4O/c1-17-9-3-2-7(4-8(9)12)16-11-5-10(13)14-6-15-11/h2-6H,1H3,(H3,13,14,15,16) |
| InChIKey | ROLCHAOWUZQRQN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |