C10H11FN4O — CID 82236271
4-N-(3-fluoro-4-methoxyphenyl)-1H-pyrazole-4,5-diamine (PubChem CID 82236271) has the molecular formula C10H11FN4O and a molecular weight of 222.22 g/mol. Its IUPAC name is 4-N-(3-fluoro-4-methoxyphenyl)-1H-pyrazole-4,5-diamine.
| Compound Name | 4-N-(3-fluoro-4-methoxyphenyl)-1H-pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 82236271 |
| Molecular Formula | C10H11FN4O |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-N-(3-fluoro-4-methoxyphenyl)-1H-pyrazole-4,5-diamine |
| SMILES | COc1ccc(Nc2cn[nH]c2N)cc1F |
| InChI | InChI=1S/C10H11FN4O/c1-16-9-3-2-6(4-7(9)11)14-8-5-13-15-10(8)12/h2-5,14H,1H3,(H3,12,13,15) |
| InChIKey | VPNGREITJOTXRS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |