C14H15FN2O3S — CID 43448114
1-N-(3-fluoro-4-methoxyphenyl)-4-methylsulfonylbenzene-1,2-diamine (PubChem CID 43448114) has the molecular formula C14H15FN2O3S and a molecular weight of 310.35 g/mol. Its IUPAC name is 1-N-(3-fluoro-4-methoxyphenyl)-4-methylsulfonylbenzene-1,2-diamine.
| Compound Name | 1-N-(3-fluoro-4-methoxyphenyl)-4-methylsulfonylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 43448114 |
| Molecular Formula | C14H15FN2O3S |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 1-N-(3-fluoro-4-methoxyphenyl)-4-methylsulfonylbenzene-1,2-diamine |
| SMILES | COc1ccc(Nc2ccc(S(C)(=O)=O)cc2N)cc1F |
| InChI | InChI=1S/C14H15FN2O3S/c1-20-14-6-3-9(7-11(14)15)17-13-5-4-10(8-12(13)16)21(2,18)19/h3-8,17H,16H2,1-2H3 |
| InChIKey | YACAQFMUKLVWGJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|