C12H10F3N3O2S — CID 62809987
3-amino-4-(3,4,5-trifluoroanilino)benzenesulfonamide (PubChem CID 62809987) has the molecular formula C12H10F3N3O2S and a molecular weight of 317.29 g/mol. Its IUPAC name is 3-amino-4-(3,4,5-trifluoroanilino)benzenesulfonamide.
| Compound Name | 3-amino-4-(3,4,5-trifluoroanilino)benzenesulfonamide |
|---|---|
| PubChem CID | 62809987 |
| Molecular Formula | C12H10F3N3O2S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 3-amino-4-(3,4,5-trifluoroanilino)benzenesulfonamide |
| SMILES | Nc1cc(S(N)(=O)=O)ccc1Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H10F3N3O2S/c13-8-3-6(4-9(14)12(8)15)18-11-2-1-7(5-10(11)16)21(17,19)20/h1-5,18H,16H2,(H2,17,19,20) |
| InChIKey | ONUSOWKFACLGID-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|