C12H8BrF3N2 — CID 55211103
4-bromo-1-N-(3,4,5-trifluorophenyl)benzene-1,2-diamine (PubChem CID 55211103) has the molecular formula C12H8BrF3N2 and a molecular weight of 317.11 g/mol. Its IUPAC name is 4-bromo-1-N-(3,4,5-trifluorophenyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-(3,4,5-trifluorophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 55211103 |
| Molecular Formula | C12H8BrF3N2 |
| Molecular Weight | 317.11 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 4-bromo-1-N-(3,4,5-trifluorophenyl)benzene-1,2-diamine |
| SMILES | Nc1cc(Br)ccc1Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H8BrF3N2/c13-6-1-2-11(10(17)3-6)18-7-4-8(14)12(16)9(15)5-7/h1-5,18H,17H2 |
| InChIKey | AXJSYPACONIJNA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.11 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|