C15H17BrN2O3 — CID 29066562
4-bromo-1-N-(3,4,5-trimethoxyphenyl)benzene-1,2-diamine (PubChem CID 29066562) has the molecular formula C15H17BrN2O3 and a molecular weight of 353.22 g/mol. Its IUPAC name is 4-bromo-1-N-(3,4,5-trimethoxyphenyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-(3,4,5-trimethoxyphenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 29066562 |
| Molecular Formula | C15H17BrN2O3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 4-bromo-1-N-(3,4,5-trimethoxyphenyl)benzene-1,2-diamine |
| SMILES | COc1cc(Nc2ccc(Br)cc2N)cc(OC)c1OC |
| InChI | InChI=1S/C15H17BrN2O3/c1-19-13-7-10(8-14(20-2)15(13)21-3)18-12-5-4-9(16)6-11(12)17/h4-8,18H,17H2,1-3H3 |
| InChIKey | BZQWQQOZDNNKCR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|