C18H23NO4 — CID 171920030
2-methoxy-4,5-dimethyl-N-(3,4,5-trimethoxyphenyl)aniline (PubChem CID 171920030) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-methoxy-4,5-dimethyl-N-(3,4,5-trimethoxyphenyl)aniline.
| Compound Name | 2-methoxy-4,5-dimethyl-N-(3,4,5-trimethoxyphenyl)aniline |
|---|---|
| PubChem CID | 171920030 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-methoxy-4,5-dimethyl-N-(3,4,5-trimethoxyphenyl)aniline |
| SMILES | COc1cc(C)c(C)cc1Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H23NO4/c1-11-7-14(15(20-3)8-12(11)2)19-13-9-16(21-4)18(23-6)17(10-13)22-5/h7-10,19H,1-6H3 |
| InChIKey | CPYSRSKFOPBHDB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |