C24H24Cl2N2O6 — CID 134454786
2,5-dichloro-3-(3-methoxy-4,5-dimethylanilino)-6-(3,4,5-trimethoxyanilino)cyclohexa-2,5-diene-1,4-dione (PubChem CID 134454786) has the molecular formula C24H24Cl2N2O6 and a molecular weight of 507.37 g/mol. Its IUPAC name is 2,5-dichloro-3-(3-methoxy-4,5-dimethylanilino)-6-(3,4,5-trimethoxyanilino)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dichloro-3-(3-methoxy-4,5-dimethylanilino)-6-(3,4,5-trimethoxyanilino)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 134454786 |
| Molecular Formula | C24H24Cl2N2O6 |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 2,5-dichloro-3-(3-methoxy-4,5-dimethylanilino)-6-(3,4,5-trimethoxyanilino)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COc1cc(NC2=C(Cl)C(=O)C(Nc3cc(OC)c(OC)c(OC)c3)=C(Cl)C2=O)cc(C)c1C |
| InChI | InChI=1S/C24H24Cl2N2O6/c1-11-7-13(8-15(31-3)12(11)2)27-20-18(25)23(30)21(19(26)22(20)29)28-14-9-16(32-4)24(34-6)17(10-14)33-5/h7-10,27-28H,1-6H3 |
| InChIKey | KWMHNRHIAUAIIQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|