C13H14ClN3O3 — CID 11609049
6-chloro-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine (PubChem CID 11609049) has the molecular formula C13H14ClN3O3 and a molecular weight of 295.73 g/mol. Its IUPAC name is 6-chloro-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine.
| Compound Name | 6-chloro-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 11609049 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 6-chloro-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine |
| SMILES | COc1cc(Nc2cncc(Cl)n2)cc(OC)c1OC |
| InChI | InChI=1S/C13H14ClN3O3/c1-18-9-4-8(5-10(19-2)13(9)20-3)16-12-7-15-6-11(14)17-12/h4-7H,1-3H3,(H,16,17) |
| InChIKey | WLISXOGSZMQLHI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |