C26H22F2N4O4 — CID 66912565
2,6-difluoro-N-[4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]phenyl]benzamide (PubChem CID 66912565) has the molecular formula C26H22F2N4O4 and a molecular weight of 492.48 g/mol. Its IUPAC name is 2,6-difluoro-N-[4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]phenyl]benzamide.
| Compound Name | 2,6-difluoro-N-[4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 66912565 |
| Molecular Formula | C26H22F2N4O4 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 2,6-difluoro-N-[4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]phenyl]benzamide |
| SMILES | COc1cc(Nc2cncc(-c3ccc(NC(=O)c4c(F)cccc4F)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H22F2N4O4/c1-34-21-11-17(12-22(35-2)25(21)36-3)30-23-14-29-13-20(32-23)15-7-9-16(10-8-15)31-26(33)24-18(27)5-4-6-19(24)28/h4-14H,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | CQZJLCDKSDLZBN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |