C26H25FN5O4+ — CID 148535392
(3-fluorophenyl)-[[4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]phenyl]carbamoyl]azanium (PubChem CID 148535392) has the molecular formula C26H25FN5O4+ and a molecular weight of 490.52 g/mol. Its IUPAC name is (3-fluorophenyl)-[[4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]phenyl]carbamoyl]azanium.
| Compound Name | (3-fluorophenyl)-[[4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]phenyl]carbamoyl]azanium |
|---|---|
| PubChem CID | 148535392 |
| Molecular Formula | C26H25FN5O4+ |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (3-fluorophenyl)-[[4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]phenyl]carbamoyl]azanium |
| SMILES | COc1cc(Nc2cncc(-c3ccc(NC(=O)[NH2+]c4cccc(F)c4)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H24FN5O4/c1-34-22-12-20(13-23(35-2)25(22)36-3)29-24-15-28-14-21(32-24)16-7-9-18(10-8-16)30-26(33)31-19-6-4-5-17(27)11-19/h4-15H,1-3H3,(H,29,32)(H2,30,31,33)/p+1 |
| InChIKey | MRCHNMWUWYQUMH-UHFFFAOYSA-O |
| XLogP | 4.48 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|