C20H21N3O4 — CID 11710382
[4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]phenyl]methanol (PubChem CID 11710382) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is [4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]phenyl]methanol.
| Compound Name | [4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 11710382 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]phenyl]methanol |
| SMILES | COc1cc(Nc2cncc(-c3ccc(CO)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21N3O4/c1-25-17-8-15(9-18(26-2)20(17)27-3)22-19-11-21-10-16(23-19)14-6-4-13(12-24)5-7-14/h4-11,24H,12H2,1-3H3,(H,22,23) |
| InChIKey | YULVNJAHDFXZIB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |