C27H24F3N5O4 — CID 162603766
5-[[6-[4-[[hydroxy-[4-(trifluoromethyl)anilino]methyl]amino]phenyl]pyrazin-2-yl]amino]-2,3-dimethoxybenzaldehyde (PubChem CID 162603766) has the molecular formula C27H24F3N5O4 and a molecular weight of 539.51 g/mol. Its IUPAC name is 5-[[6-[4-[[hydroxy-[4-(trifluoromethyl)anilino]methyl]amino]phenyl]pyrazin-2-yl]amino]-2,3-dimethoxybenzaldehyde.
| Compound Name | 5-[[6-[4-[[hydroxy-[4-(trifluoromethyl)anilino]methyl]amino]phenyl]pyrazin-2-yl]amino]-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 162603766 |
| Molecular Formula | C27H24F3N5O4 |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 5-[[6-[4-[[hydroxy-[4-(trifluoromethyl)anilino]methyl]amino]phenyl]pyrazin-2-yl]amino]-2,3-dimethoxybenzaldehyde |
| SMILES | COc1cc(Nc2cncc(-c3ccc(NC(O)Nc4ccc(C(F)(F)F)cc4)cc3)n2)cc(C=O)c1OC |
| InChI | InChI=1S/C27H24F3N5O4/c1-38-23-12-21(11-17(15-36)25(23)39-2)32-24-14-31-13-22(35-24)16-3-7-19(8-4-16)33-26(37)34-20-9-5-18(6-10-20)27(28,29)30/h3-15,26,33-34,37H,1-2H3,(H,32,35) |
| InChIKey | YAVXUCJKTLYGCN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|