C17H13F3N4 — CID 118094690
6-(2-methyl-4-pyridinyl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine (PubChem CID 118094690) has the molecular formula C17H13F3N4 and a molecular weight of 330.31 g/mol. Its IUPAC name is 6-(2-methyl-4-pyridinyl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine.
| Compound Name | 6-(2-methyl-4-pyridinyl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 118094690 |
| Molecular Formula | C17H13F3N4 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 6-(2-methyl-4-pyridinyl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine |
| SMILES | Cc1cc(-c2cncc(Nc3ccc(C(F)(F)F)cc3)n2)ccn1 |
| InChI | InChI=1S/C17H13F3N4/c1-11-8-12(6-7-22-11)15-9-21-10-16(24-15)23-14-4-2-13(3-5-14)17(18,19)20/h2-10H,1H3,(H,23,24) |
| InChIKey | HNHRJEGOXNDWOA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |