C20H22ClN5O2 — CID 142130325
N-(3-chlorophenyl)-6-(2-methyl-4-pyridinyl)pyrazin-2-amine;N-(3-hydroxypropyl)formamide (PubChem CID 142130325) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6-(2-methyl-4-pyridinyl)pyrazin-2-amine;N-(3-hydroxypropyl)formamide.
| Compound Name | N-(3-chlorophenyl)-6-(2-methyl-4-pyridinyl)pyrazin-2-amine;N-(3-hydroxypropyl)formamide |
|---|---|
| PubChem CID | 142130325 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-(3-chlorophenyl)-6-(2-methyl-4-pyridinyl)pyrazin-2-amine;N-(3-hydroxypropyl)formamide |
| SMILES | Cc1cc(-c2cncc(Nc3cccc(Cl)c3)n2)ccn1.O=CNCCCO |
| InChI | InChI=1S/C16H13ClN4.C4H9NO2/c1-11-7-12(5-6-19-11)15-9-18-10-16(21-15)20-14-4-2-3-13(17)8-14;6-3-1-2-5-4-7/h2-10H,1H3,(H,20,21);4,6H,1-3H2,(H,5,7) |
| InChIKey | DTWWCYZVFAIGIQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|