C22H26ClN7 — CID 5330378
N-(3-chlorophenyl)-6-[5-(3-piperazin-1-ylpropylamino)-3-pyridinyl]pyrazin-2-amine (PubChem CID 5330378) has the molecular formula C22H26ClN7 and a molecular weight of 423.95 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6-[5-(3-piperazin-1-ylpropylamino)-3-pyridinyl]pyrazin-2-amine.
| Compound Name | N-(3-chlorophenyl)-6-[5-(3-piperazin-1-ylpropylamino)-3-pyridinyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 5330378 |
| Molecular Formula | C22H26ClN7 |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-(3-chlorophenyl)-6-[5-(3-piperazin-1-ylpropylamino)-3-pyridinyl]pyrazin-2-amine |
| SMILES | Clc1cccc(Nc2cncc(-c3cncc(NCCCN4CCNCC4)c3)n2)c1 |
| InChI | InChI=1S/C22H26ClN7/c23-18-3-1-4-19(12-18)28-22-16-26-15-21(29-22)17-11-20(14-25-13-17)27-5-2-8-30-9-6-24-7-10-30/h1,3-4,11-16,24,27H,2,5-10H2,(H,28,29) |
| InChIKey | DERTUZZNGDWMOY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|