C10H16ClN5 — CID 116650770
6-chloro-N-(2-piperazin-1-ylethyl)pyrazin-2-amine (PubChem CID 116650770) has the molecular formula C10H16ClN5 and a molecular weight of 241.73 g/mol. Its IUPAC name is 6-chloro-N-(2-piperazin-1-ylethyl)pyrazin-2-amine.
| Compound Name | 6-chloro-N-(2-piperazin-1-ylethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 116650770 |
| Molecular Formula | C10H16ClN5 |
| Molecular Weight | 241.73 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 6-chloro-N-(2-piperazin-1-ylethyl)pyrazin-2-amine |
| SMILES | Clc1cncc(NCCN2CCNCC2)n1 |
| InChI | InChI=1S/C10H16ClN5/c11-9-7-13-8-10(15-9)14-3-6-16-4-1-12-2-5-16/h7-8,12H,1-6H2,(H,14,15) |
| InChIKey | OYKNJUOXLVWPSG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.73 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |