C11H20N6 — CID 10354114
6-methyl-4-N-(2-piperazin-1-ylethyl)pyrimidine-2,4-diamine (PubChem CID 10354114) has the molecular formula C11H20N6 and a molecular weight of 236.32 g/mol. Its IUPAC name is 6-methyl-4-N-(2-piperazin-1-ylethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-4-N-(2-piperazin-1-ylethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10354114 |
| Molecular Formula | C11H20N6 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 6-methyl-4-N-(2-piperazin-1-ylethyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(NCCN2CCNCC2)nc(N)n1 |
| InChI | InChI=1S/C11H20N6/c1-9-8-10(16-11(12)15-9)14-4-7-17-5-2-13-3-6-17/h8,13H,2-7H2,1H3,(H3,12,14,15,16) |
| InChIKey | FNBCQTSCNIKQQB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |