C23H26ClN5 — CID 24798343
2-N-[3-(3-chlorophenyl)phenyl]-4-N-(3-pyrrolidin-1-ylpropyl)pyrimidine-2,4-diamine (PubChem CID 24798343) has the molecular formula C23H26ClN5 and a molecular weight of 407.95 g/mol. Its IUPAC name is 2-N-[3-(3-chlorophenyl)phenyl]-4-N-(3-pyrrolidin-1-ylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(3-chlorophenyl)phenyl]-4-N-(3-pyrrolidin-1-ylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 24798343 |
| Molecular Formula | C23H26ClN5 |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-N-[3-(3-chlorophenyl)phenyl]-4-N-(3-pyrrolidin-1-ylpropyl)pyrimidine-2,4-diamine |
| SMILES | Clc1cccc(-c2cccc(Nc3nccc(NCCCN4CCCC4)n3)c2)c1 |
| InChI | InChI=1S/C23H26ClN5/c24-20-8-3-6-18(16-20)19-7-4-9-21(17-19)27-23-26-12-10-22(28-23)25-11-5-15-29-13-1-2-14-29/h3-4,6-10,12,16-17H,1-2,5,11,13-15H2,(H2,25,26,27,28) |
| InChIKey | TZNYKXMGFKVINJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|