C22H26N6O — CID 24797792
4-N-(3-morpholin-4-ylpropyl)-2-N-(3-pyridin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 24797792) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 4-N-(3-morpholin-4-ylpropyl)-2-N-(3-pyridin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-morpholin-4-ylpropyl)-2-N-(3-pyridin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 24797792 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 4-N-(3-morpholin-4-ylpropyl)-2-N-(3-pyridin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | c1cc(Nc2nccc(NCCCN3CCOCC3)n2)cc(-c2ccncc2)c1 |
| InChI | InChI=1S/C22H26N6O/c1-3-19(18-5-9-23-10-6-18)17-20(4-1)26-22-25-11-7-21(27-22)24-8-2-12-28-13-15-29-16-14-28/h1,3-7,9-11,17H,2,8,12-16H2,(H2,24,25,26,27) |
| InChIKey | ZCJMBIQJYXQBIA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|