C18H24N6O2 — CID 112887387
N-[3-[[4-(2-morpholin-4-ylethylamino)pyrimidin-2-yl]amino]phenyl]acetamide (PubChem CID 112887387) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[3-[[4-(2-morpholin-4-ylethylamino)pyrimidin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[4-(2-morpholin-4-ylethylamino)pyrimidin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112887387 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-[3-[[4-(2-morpholin-4-ylethylamino)pyrimidin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2nccc(NCCN3CCOCC3)n2)c1 |
| InChI | InChI=1S/C18H24N6O2/c1-14(25)21-15-3-2-4-16(13-15)22-18-20-6-5-17(23-18)19-7-8-24-9-11-26-12-10-24/h2-6,13H,7-12H2,1H3,(H,21,25)(H2,19,20,22,23) |
| InChIKey | SDJIIVJDVFHCQT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |