C19H18FN5O — CID 112891467
N-[3-[[4-[(4-fluorophenyl)methylamino]pyrimidin-2-yl]amino]phenyl]acetamide (PubChem CID 112891467) has the molecular formula C19H18FN5O and a molecular weight of 351.39 g/mol. Its IUPAC name is N-[3-[[4-[(4-fluorophenyl)methylamino]pyrimidin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[4-[(4-fluorophenyl)methylamino]pyrimidin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112891467 |
| Molecular Formula | C19H18FN5O |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-[3-[[4-[(4-fluorophenyl)methylamino]pyrimidin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2nccc(NCc3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C19H18FN5O/c1-13(26)23-16-3-2-4-17(11-16)24-19-21-10-9-18(25-19)22-12-14-5-7-15(20)8-6-14/h2-11H,12H2,1H3,(H,23,26)(H2,21,22,24,25) |
| InChIKey | ITPMEZVLADTZJZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |