C25H31N5O — CID 24798064
2-N-[3-(3-methoxyphenyl)phenyl]-4-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine (PubChem CID 24798064) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-N-[3-(3-methoxyphenyl)phenyl]-4-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(3-methoxyphenyl)phenyl]-4-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 24798064 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 2-N-[3-(3-methoxyphenyl)phenyl]-4-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine |
| SMILES | COc1cccc(-c2cccc(Nc3nccc(NCCCN4CCCCC4)n3)c2)c1 |
| InChI | InChI=1S/C25H31N5O/c1-31-23-11-6-9-21(19-23)20-8-5-10-22(18-20)28-25-27-14-12-24(29-25)26-13-7-17-30-15-3-2-4-16-30/h5-6,8-12,14,18-19H,2-4,7,13,15-17H2,1H3,(H2,26,27,28,29) |
| InChIKey | UDOOTIPQENXNFE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|