C22H23ClN6 — CID 90871154
2-N-[3-(3-chlorophenyl)phenyl]-4-N-[3-(2,4-dihydroimidazol-3-yl)propyl]pyrimidine-2,4-diamine (PubChem CID 90871154) has the molecular formula C22H23ClN6 and a molecular weight of 406.92 g/mol. Its IUPAC name is 2-N-[3-(3-chlorophenyl)phenyl]-4-N-[3-(2,4-dihydroimidazol-3-yl)propyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(3-chlorophenyl)phenyl]-4-N-[3-(2,4-dihydroimidazol-3-yl)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 90871154 |
| Molecular Formula | C22H23ClN6 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-N-[3-(3-chlorophenyl)phenyl]-4-N-[3-(2,4-dihydroimidazol-3-yl)propyl]pyrimidine-2,4-diamine |
| SMILES | Clc1cccc(-c2cccc(Nc3nccc(NCCCN4CC=NC4)n3)c2)c1 |
| InChI | InChI=1S/C22H23ClN6/c23-19-6-1-4-17(14-19)18-5-2-7-20(15-18)27-22-26-10-8-21(28-22)25-9-3-12-29-13-11-24-16-29/h1-2,4-8,10-11,14-15H,3,9,12-13,16H2,(H2,25,26,27,28) |
| InChIKey | PMJITVPUALMFNF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|