C23H27N7O2 — CID 24798345
2-N-[3-(3-nitrophenyl)phenyl]-4-N-(3-piperazin-1-ylpropyl)pyrimidine-2,4-diamine (PubChem CID 24798345) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 2-N-[3-(3-nitrophenyl)phenyl]-4-N-(3-piperazin-1-ylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(3-nitrophenyl)phenyl]-4-N-(3-piperazin-1-ylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 24798345 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-N-[3-(3-nitrophenyl)phenyl]-4-N-(3-piperazin-1-ylpropyl)pyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cccc(-c2cccc(Nc3nccc(NCCCN4CCNCC4)n3)c2)c1 |
| InChI | InChI=1S/C23H27N7O2/c31-30(32)21-7-2-5-19(17-21)18-4-1-6-20(16-18)27-23-26-10-8-22(28-23)25-9-3-13-29-14-11-24-12-15-29/h1-2,4-8,10,16-17,24H,3,9,11-15H2,(H2,25,26,27,28) |
| InChIKey | WXCZJQFGGCUHEA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|