C25H29N7 — CID 24798522
2-N-[3-(1H-indol-3-yl)phenyl]-4-N-(3-piperazin-1-ylpropyl)pyrimidine-2,4-diamine (PubChem CID 24798522) has the molecular formula C25H29N7 and a molecular weight of 427.56 g/mol. Its IUPAC name is 2-N-[3-(1H-indol-3-yl)phenyl]-4-N-(3-piperazin-1-ylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(1H-indol-3-yl)phenyl]-4-N-(3-piperazin-1-ylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 24798522 |
| Molecular Formula | C25H29N7 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-N-[3-(1H-indol-3-yl)phenyl]-4-N-(3-piperazin-1-ylpropyl)pyrimidine-2,4-diamine |
| SMILES | c1cc(Nc2nccc(NCCCN3CCNCC3)n2)cc(-c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C25H29N7/c1-2-8-23-21(7-1)22(18-29-23)19-5-3-6-20(17-19)30-25-28-11-9-24(31-25)27-10-4-14-32-15-12-26-13-16-32/h1-3,5-9,11,17-18,26,29H,4,10,12-16H2,(H2,27,28,30,31) |
| InChIKey | KGCODYNSOQHKLZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|