C24H25N7 — CID 140520844
4-N-[3-(1,3-dihydropyrazol-2-yl)propyl]-2-N-[3-(1H-indol-3-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 140520844) has the molecular formula C24H25N7 and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-N-[3-(1,3-dihydropyrazol-2-yl)propyl]-2-N-[3-(1H-indol-3-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(1,3-dihydropyrazol-2-yl)propyl]-2-N-[3-(1H-indol-3-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 140520844 |
| Molecular Formula | C24H25N7 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 4-N-[3-(1,3-dihydropyrazol-2-yl)propyl]-2-N-[3-(1H-indol-3-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | C1=CNN(CCCNc2ccnc(Nc3cccc(-c4c[nH]c5ccccc45)c3)n2)C1 |
| InChI | InChI=1S/C24H25N7/c1-2-9-22-20(8-1)21(17-27-22)18-6-3-7-19(16-18)29-24-26-13-10-23(30-24)25-11-4-14-31-15-5-12-28-31/h1-3,5-10,12-13,16-17,27-28H,4,11,14-15H2,(H2,25,26,29,30) |
| InChIKey | OYQJBNAWZJIZGM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|