C25H26N6 — CID 68912029
4-N-[3-(2,5-dihydropyrrol-1-yl)propyl]-5-[3-(1H-indol-3-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 68912029) has the molecular formula C25H26N6 and a molecular weight of 410.53 g/mol. Its IUPAC name is 4-N-[3-(2,5-dihydropyrrol-1-yl)propyl]-5-[3-(1H-indol-3-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(2,5-dihydropyrrol-1-yl)propyl]-5-[3-(1H-indol-3-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68912029 |
| Molecular Formula | C25H26N6 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 4-N-[3-(2,5-dihydropyrrol-1-yl)propyl]-5-[3-(1H-indol-3-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(-c2cccc(-c3c[nH]c4ccccc34)c2)c(NCCCN2CC=CC2)n1 |
| InChI | InChI=1S/C25H26N6/c26-25-29-17-22(24(30-25)27-11-6-14-31-12-3-4-13-31)19-8-5-7-18(15-19)21-16-28-23-10-2-1-9-20(21)23/h1-5,7-10,15-17,28H,6,11-14H2,(H3,26,27,29,30) |
| InChIKey | DWAUCRWVVFWCOC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|