C26H30N6 — CID 68920042
5-[3-(1H-indol-3-yl)phenyl]-4-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine (PubChem CID 68920042) has the molecular formula C26H30N6 and a molecular weight of 426.57 g/mol. Its IUPAC name is 5-[3-(1H-indol-3-yl)phenyl]-4-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 5-[3-(1H-indol-3-yl)phenyl]-4-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68920042 |
| Molecular Formula | C26H30N6 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 5-[3-(1H-indol-3-yl)phenyl]-4-N-(3-piperidin-1-ylpropyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(-c2cccc(-c3c[nH]c4ccccc34)c2)c(NCCCN2CCCCC2)n1 |
| InChI | InChI=1S/C26H30N6/c27-26-30-18-23(25(31-26)28-12-7-15-32-13-4-1-5-14-32)20-9-6-8-19(16-20)22-17-29-24-11-3-2-10-21(22)24/h2-3,6,8-11,16-18,29H,1,4-5,7,12-15H2,(H3,27,28,30,31) |
| InChIKey | PCQXDKZJRYVILK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|