C24H29N5O — CID 68920820
5-[3-(3-methylphenyl)phenyl]-4-N-(3-morpholin-4-ylpropyl)pyrimidine-2,4-diamine (PubChem CID 68920820) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is 5-[3-(3-methylphenyl)phenyl]-4-N-(3-morpholin-4-ylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 5-[3-(3-methylphenyl)phenyl]-4-N-(3-morpholin-4-ylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68920820 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 5-[3-(3-methylphenyl)phenyl]-4-N-(3-morpholin-4-ylpropyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cccc(-c2cccc(-c3cnc(N)nc3NCCCN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C24H29N5O/c1-18-5-2-6-19(15-18)20-7-3-8-21(16-20)22-17-27-24(25)28-23(22)26-9-4-10-29-11-13-30-14-12-29/h2-3,5-8,15-17H,4,9-14H2,1H3,(H3,25,26,27,28) |
| InChIKey | XUJJXZJGXYLBMX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|