C19H21F6N5O — CID 87621675
5-[3,5-bis(trifluoromethyl)phenyl]-4-N-(3-morpholin-4-ylpropyl)pyrimidine-2,4-diamine (PubChem CID 87621675) has the molecular formula C19H21F6N5O and a molecular weight of 449.40 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-4-N-(3-morpholin-4-ylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-4-N-(3-morpholin-4-ylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 87621675 |
| Molecular Formula | C19H21F6N5O |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-4-N-(3-morpholin-4-ylpropyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(NCCCN2CCOCC2)n1 |
| InChI | InChI=1S/C19H21F6N5O/c20-18(21,22)13-8-12(9-14(10-13)19(23,24)25)15-11-28-17(26)29-16(15)27-2-1-3-30-4-6-31-7-5-30/h8-11H,1-7H2,(H3,26,27,28,29) |
| InChIKey | VIBXNXQHBCGKJR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|