C20H22F3N5O — CID 126473906
N-(3-morpholin-4-ylpropyl)-3-[3-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 126473906) has the molecular formula C20H22F3N5O and a molecular weight of 405.42 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-3-[3-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(3-morpholin-4-ylpropyl)-3-[3-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 126473906 |
| Molecular Formula | C20H22F3N5O |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-3-[3-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | FC(F)(F)c1cccc(-c2cnn3c(NCCCN4CCOCC4)ccnc23)c1 |
| InChI | InChI=1S/C20H22F3N5O/c21-20(22,23)16-4-1-3-15(13-16)17-14-26-28-18(5-7-25-19(17)28)24-6-2-8-27-9-11-29-12-10-27/h1,3-5,7,13-14,24H,2,6,8-12H2 |
| InChIKey | YWHVKZDEFKGNRI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|