C22H23F3N4O — CID 22129191
4-[3-[5-pyridin-4-yl-2-[3-(trifluoromethyl)phenyl]imidazol-1-yl]propyl]morpholine (PubChem CID 22129191) has the molecular formula C22H23F3N4O and a molecular weight of 416.45 g/mol. Its IUPAC name is 4-[3-[5-pyridin-4-yl-2-[3-(trifluoromethyl)phenyl]imidazol-1-yl]propyl]morpholine.
| Compound Name | 4-[3-[5-pyridin-4-yl-2-[3-(trifluoromethyl)phenyl]imidazol-1-yl]propyl]morpholine |
|---|---|
| PubChem CID | 22129191 |
| Molecular Formula | C22H23F3N4O |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-[3-[5-pyridin-4-yl-2-[3-(trifluoromethyl)phenyl]imidazol-1-yl]propyl]morpholine |
| SMILES | FC(F)(F)c1cccc(-c2ncc(-c3ccncc3)n2CCCN2CCOCC2)c1 |
| InChI | InChI=1S/C22H23F3N4O/c23-22(24,25)19-4-1-3-18(15-19)21-27-16-20(17-5-7-26-8-6-17)29(21)10-2-9-28-11-13-30-14-12-28/h1,3-8,15-16H,2,9-14H2 |
| InChIKey | AKKKGCNVUINJEW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |