C25H26F3N5O2 — CID 148671648
1-[4-[2-(3-morpholin-4-ylpropyl)pyrimidin-5-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 148671648) has the molecular formula C25H26F3N5O2 and a molecular weight of 485.51 g/mol. Its IUPAC name is 1-[4-[2-(3-morpholin-4-ylpropyl)pyrimidin-5-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[2-(3-morpholin-4-ylpropyl)pyrimidin-5-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 148671648 |
| Molecular Formula | C25H26F3N5O2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 1-[4-[2-(3-morpholin-4-ylpropyl)pyrimidin-5-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2cnc(CCCN3CCOCC3)nc2)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H26F3N5O2/c26-25(27,28)20-3-1-4-22(15-20)32-24(34)31-21-8-6-18(7-9-21)19-16-29-23(30-17-19)5-2-10-33-11-13-35-14-12-33/h1,3-4,6-9,15-17H,2,5,10-14H2,(H2,31,32,34) |
| InChIKey | NPVKUUYLIFROFN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |