C21H23F4N3O3 — CID 25015205
1-[4-fluoro-3-(3-morpholin-4-ylpropoxy)phenyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 25015205) has the molecular formula C21H23F4N3O3 and a molecular weight of 441.43 g/mol. Its IUPAC name is 1-[4-fluoro-3-(3-morpholin-4-ylpropoxy)phenyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-fluoro-3-(3-morpholin-4-ylpropoxy)phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 25015205 |
| Molecular Formula | C21H23F4N3O3 |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1-[4-fluoro-3-(3-morpholin-4-ylpropoxy)phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1ccc(F)c(OCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C21H23F4N3O3/c22-18-7-6-17(14-19(18)31-11-1-8-28-9-12-30-13-10-28)27-20(29)26-16-4-2-15(3-5-16)21(23,24)25/h2-7,14H,1,8-13H2,(H2,26,27,29) |
| InChIKey | WJWOHQXQFPUUDU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|