C21H24F3N3O4 — CID 25015279
1-[4-(3-morpholin-4-ylpropoxy)phenyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 25015279) has the molecular formula C21H24F3N3O4 and a molecular weight of 439.43 g/mol. Its IUPAC name is 1-[4-(3-morpholin-4-ylpropoxy)phenyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[4-(3-morpholin-4-ylpropoxy)phenyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 25015279 |
| Molecular Formula | C21H24F3N3O4 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 1-[4-(3-morpholin-4-ylpropoxy)phenyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OCCCN2CCOCC2)cc1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H24F3N3O4/c22-21(23,24)31-19-8-4-17(5-9-19)26-20(28)25-16-2-6-18(7-3-16)30-13-1-10-27-11-14-29-15-12-27/h2-9H,1,10-15H2,(H2,25,26,28) |
| InChIKey | MHYBNAYVNVIZDS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|