C22H36N2O4 — CID 100723548
(2S)-2-ethoxy-2,4-dimethyl-N-[4-(3-morpholin-4-ylpropoxy)phenyl]pentanamide (PubChem CID 100723548) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is (2S)-2-ethoxy-2,4-dimethyl-N-[4-(3-morpholin-4-ylpropoxy)phenyl]pentanamide.
| Compound Name | (2S)-2-ethoxy-2,4-dimethyl-N-[4-(3-morpholin-4-ylpropoxy)phenyl]pentanamide |
|---|---|
| PubChem CID | 100723548 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (2S)-2-ethoxy-2,4-dimethyl-N-[4-(3-morpholin-4-ylpropoxy)phenyl]pentanamide |
| SMILES | CCO[C@@](C)(CC(C)C)C(=O)Nc1ccc(OCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C22H36N2O4/c1-5-28-22(4,17-18(2)3)21(25)23-19-7-9-20(10-8-19)27-14-6-11-24-12-15-26-16-13-24/h7-10,18H,5-6,11-17H2,1-4H3,(H,23,25)/t22-/m0/s1 |
| InChIKey | LPTWUHFKDVOUKR-QFIPXVFZSA-N |
| XLogP | 3.57 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|