C18H29NO4 — CID 133246574
2-ethoxy-N-[4-(2-methoxyethoxy)phenyl]-2,4-dimethylpentanamide (PubChem CID 133246574) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 2-ethoxy-N-[4-(2-methoxyethoxy)phenyl]-2,4-dimethylpentanamide.
| Compound Name | 2-ethoxy-N-[4-(2-methoxyethoxy)phenyl]-2,4-dimethylpentanamide |
|---|---|
| PubChem CID | 133246574 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2-ethoxy-N-[4-(2-methoxyethoxy)phenyl]-2,4-dimethylpentanamide |
| SMILES | CCOC(C)(CC(C)C)C(=O)Nc1ccc(OCCOC)cc1 |
| InChI | InChI=1S/C18H29NO4/c1-6-23-18(4,13-14(2)3)17(20)19-15-7-9-16(10-8-15)22-12-11-21-5/h7-10,14H,6,11-13H2,1-5H3,(H,19,20) |
| InChIKey | OEFKZMPQWXNARC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|