C18H29NO3 — CID 100722919
(2R)-2-ethoxy-2,4-dimethyl-N-(4-propan-2-yloxyphenyl)pentanamide (PubChem CID 100722919) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is (2R)-2-ethoxy-2,4-dimethyl-N-(4-propan-2-yloxyphenyl)pentanamide.
| Compound Name | (2R)-2-ethoxy-2,4-dimethyl-N-(4-propan-2-yloxyphenyl)pentanamide |
|---|---|
| PubChem CID | 100722919 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (2R)-2-ethoxy-2,4-dimethyl-N-(4-propan-2-yloxyphenyl)pentanamide |
| SMILES | CCO[C@](C)(CC(C)C)C(=O)Nc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C18H29NO3/c1-7-21-18(6,12-13(2)3)17(20)19-15-8-10-16(11-9-15)22-14(4)5/h8-11,13-14H,7,12H2,1-6H3,(H,19,20)/t18-/m1/s1 |
| InChIKey | WFGOUSDLZDCQKJ-GOSISDBHSA-N |
| XLogP | 4.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |