C17H27NO3 — CID 100723689
(2R)-2-ethoxy-N-(4-methoxy-3-methylphenyl)-2,4-dimethylpentanamide (PubChem CID 100723689) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is (2R)-2-ethoxy-N-(4-methoxy-3-methylphenyl)-2,4-dimethylpentanamide.
| Compound Name | (2R)-2-ethoxy-N-(4-methoxy-3-methylphenyl)-2,4-dimethylpentanamide |
|---|---|
| PubChem CID | 100723689 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | (2R)-2-ethoxy-N-(4-methoxy-3-methylphenyl)-2,4-dimethylpentanamide |
| SMILES | CCO[C@](C)(CC(C)C)C(=O)Nc1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C17H27NO3/c1-7-21-17(5,11-12(2)3)16(19)18-14-8-9-15(20-6)13(4)10-14/h8-10,12H,7,11H2,1-6H3,(H,18,19)/t17-/m1/s1 |
| InChIKey | WEZKKZDKNIHLLE-QGZVFWFLSA-N |
| XLogP | 3.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |